CAS 61903-30-8 is the registry number for (R,S)-4-Hydroxy Cyclophosphamide Preparation Kit. Offered by: TRC, Biosynth. Available pack sizes: 5mg.
(2R,4S)-2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2lambda5-oxazaphosphinan-4-ol (CAS 61903-30-8) is a chemical compound with the molecular formula C7H15Cl2N2O3P and a molecular weight of 277.08 g/mol. IUPAC name: (2R,4S)-2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2lambda5-oxazaphosphinan-4-ol. InChIKey: RANONBLIHMVXAJ-NZFNHWASSA-N.
| Molecular formula | C7H15Cl2N2O3P |
|---|---|
| Molecular weight | 277.08 g/mol |
| IUPAC name | (2R,4S)-2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2lambda5-oxazaphosphinan-4-ol |
| InChIKey | RANONBLIHMVXAJ-NZFNHWASSA-N |
| SMILES | C1CO[P@](=O)(N[C@H]1O)N(CCCl)CCCl |
Computed by PubChem (NCBI)