CAS 61931-02-0 is the registry number for Acid Black 194 (Technical Grade). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
Sodium 3-hydroxy-4-[(2-hydroxynaphthalen-1-yl)diazenyl]-7-nitronaphthalene-1-sulfonate (CAS 61931-02-0) is a chemical compound with the molecular formula C20H12N3NaO7S and a molecular weight of 461.4 g/mol. IUPAC name: sodium 3-hydroxy-4-[(2-hydroxynaphthalen-1-yl)diazenyl]-7-nitronaphthalene-1-sulfonate. InChIKey: DXRWYIKGBIPGAG-UHFFFAOYSA-M.
| Molecular formula | C20H12N3NaO7S |
|---|---|
| Molecular weight | 461.4 g/mol |
| IUPAC name | sodium 3-hydroxy-4-[(2-hydroxynaphthalen-1-yl)diazenyl]-7-nitronaphthalene-1-sulfonate |
| InChIKey | DXRWYIKGBIPGAG-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2N=NC3=C4C=CC(=CC4=C(C=C3O)S(=O)(=O)[O-])[N+](=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)