Products 619319-96-9
CAS 619319-96-9 appears in our catalog under these names: N-Methyl-Aniline-d5, N-Methylaniline-2,3,4,5,6-d5, N-Methylaniline-2,3,4,5,6-d5, 99 atom % D, min 98% Chemical Purity. Offered by: Chemat Brand, TRC, CDN. Available pack sizes: on request, 10mg, 2,5mg, 5mg, 0,25g, 0,1g.
2,3,4,5,6-pentadeuterio-N-methylaniline (CAS 619319-96-9) is a chemical compound with the molecular formula C7H9N and a molecular weight of 112.18 g/mol. IUPAC name: 2,3,4,5,6-pentadeuterio-N-methylaniline. InChIKey: AFBPFSWMIHJQDM-VIQYUKPQSA-N.
| Molecular formula | C7H9N |
|---|---|
| Molecular weight | 112.18 g/mol |
| IUPAC name | 2,3,4,5,6-pentadeuterio-N-methylaniline |
| InChIKey | AFBPFSWMIHJQDM-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NC)[2H])[2H] |
Computed by PubChem (NCBI)