Products 619320-40-0
CAS 619320-40-0 is the registry number for 3-Aminodihydro-d2-2(3H)-thiophenone-4,5-d2. Offered by: TRC. Available pack sizes: 10mg.
3-amino-4,4,5,5-tetradeuteriothiolan-2-one (CAS 619320-40-0) is a chemical compound with the molecular formula C4H7NOS and a molecular weight of 121.20 g/mol. IUPAC name: 3-amino-4,4,5,5-tetradeuteriothiolan-2-one. InChIKey: KIWQWJKWBHZMDT-LNLMKGTHSA-N.
| Molecular formula | C4H7NOS |
|---|---|
| Molecular weight | 121.20 g/mol |
| IUPAC name | 3-amino-4,4,5,5-tetradeuteriothiolan-2-one |
| InChIKey | KIWQWJKWBHZMDT-LNLMKGTHSA-N |
| SMILES | [2H]C1(C(C(=O)SC1([2H])[2H])N)[2H] |
Computed by PubChem (NCBI)