CAS 61941-62-6 appears in our catalog under these names: Bromfenac Impurity 32 Sodium Salt, Bromfenac Impurity 32. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Sodium 2-[2-amino-3-(4-chlorobenzoyl)phenyl]acetate (CAS 61941-62-6) is a chemical compound with the molecular formula C15H11ClNNaO3 and a molecular weight of 311.69 g/mol. IUPAC name: sodium 2-[2-amino-3-(4-chlorobenzoyl)phenyl]acetate. InChIKey: FVBKCOXGVZPEDP-UHFFFAOYSA-M.
| Molecular formula | C15H11ClNNaO3 |
|---|---|
| Molecular weight | 311.69 g/mol |
| IUPAC name | sodium 2-[2-amino-3-(4-chlorobenzoyl)phenyl]acetate |
| InChIKey | FVBKCOXGVZPEDP-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C(=C1)C(=O)C2=CC=C(C=C2)Cl)N)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)