CAS 61953-08-0 appears in our catalog under these names: 2-Chloro-5-(3,4-dihydro-1h-isoquinoline-2-sulfonyl)-benzoic acid, 95%, 2-Chloro-5-(1,2,3,4-tetrahydroisoquinoline-2-sulfonyl)benzoic acid, 95%, 2-Chloro-5-(1,2,3,4-tetrahydroisoquinoline-2-sulfonyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-chloro-5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoic acid (CAS 61953-08-0) is a chemical compound with the molecular formula C16H14ClNO4S and a molecular weight of 351.8 g/mol. IUPAC name: 2-chloro-5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoic acid. InChIKey: ZQASRJZDHNXUQG-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNO4S |
|---|---|
| Molecular weight | 351.8 g/mol |
| IUPAC name | 2-chloro-5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoic acid |
| InChIKey | ZQASRJZDHNXUQG-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)S(=O)(=O)C3=CC(=C(C=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)