CAS 61960-95-0 appears in our catalog under these names: 3-(tert-Butyl)benzene-1,2-diamine, 95+%, 3-tert-Butylbenzene-1,2-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-tert-butylbenzene-1,2-diamine (CAS 61960-95-0) is a chemical compound with the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. IUPAC name: 3-tert-butylbenzene-1,2-diamine. InChIKey: BBXDHQVTOYIHJA-UHFFFAOYSA-N.
| Molecular formula | C10H16N2 |
|---|---|
| Molecular weight | 164.25 g/mol |
| IUPAC name | 3-tert-butylbenzene-1,2-diamine |
| InChIKey | BBXDHQVTOYIHJA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=CC=C1)N)N |
Computed by PubChem (NCBI)