CAS 6198-58-9 appears in our catalog under these names: Trans-11-octadecenoic acid methyl ester, 95%, Vaccenic Acid Methyl Ester, >95% (GC), trans–Vaccenic Acid methyl ester, Methyl trans-11-Octadecenoate, >98.0%(GC), trans-Methyl vaccenate. Offered by: Combi-blocks, TRC, GLPBio, TCI, Biosynth. Available pack sizes: 100mg, 1g, 25mg, 250mg, 50mg, 500mg, 5000mg, 10000mg.
Methyl (E)-octadec-11-enoate (CAS 6198-58-9) is a chemical compound with the molecular formula C19H36O2 and a molecular weight of 296.5 g/mol. IUPAC name: methyl (E)-octadec-11-enoate. InChIKey: PVVODBCDJBGMJL-CMDGGOBGSA-N.
| Molecular formula | C19H36O2 |
|---|---|
| Molecular weight | 296.5 g/mol |
| IUPAC name | methyl (E)-octadec-11-enoate |
| InChIKey | PVVODBCDJBGMJL-CMDGGOBGSA-N |
| SMILES | CCCCCC/C=C/CCCCCCCCCC(=O)OC |
Computed by PubChem (NCBI)