CAS 620-95-1 appears in our catalog under these names: 3-Benzylpyridine, 98%, 3–Benzylpyridine, 3-Benzylpyridine, >98.0%(GC), 3-Benzylpyridine 98%, 3-Benzylpyridine, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g, 25g.
3-benzylpyridine (CAS 620-95-1) is a chemical compound with the molecular formula C12H11N and a molecular weight of 169.22 g/mol. IUPAC name: 3-benzylpyridine. InChIKey: UUCLVSDUMKMBSM-UHFFFAOYSA-N.
| Molecular formula | C12H11N |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | 3-benzylpyridine |
| InChIKey | UUCLVSDUMKMBSM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CN=CC=C2 |
Computed by PubChem (NCBI)