CAS 62004-35-7 appears in our catalog under these names: Lfm-a13, 95%, LFM-A13, LFM-A13, >98.0%(HPLC), LFM-A13, ≥98%(HPLC), ≥98%(HPLC), LFM-A13, 99.65%. Offered by: Combi-blocks, Biosynth, TCI, Chemat, MedChemExpress. Available pack sizes: 10mg, 50mg, 100mg, 5mg, 25mg, 250mg, 10 mg, 5 mg.
2-cyano-N-(2,5-dibromophenyl)-3-hydroxybut-2-enamide (CAS 62004-35-7) is a chemical compound with the molecular formula C11H8Br2N2O2 and a molecular weight of 360.00 g/mol. IUPAC name: 2-cyano-N-(2,5-dibromophenyl)-3-hydroxybut-2-enamide. InChIKey: UVSVTDVJQAJIFG-UHFFFAOYSA-N.
| Molecular formula | C11H8Br2N2O2 |
|---|---|
| Molecular weight | 360.00 g/mol |
| IUPAC name | 2-cyano-N-(2,5-dibromophenyl)-3-hydroxybut-2-enamide |
| InChIKey | UVSVTDVJQAJIFG-UHFFFAOYSA-N |
| SMILES | CC(=C(C#N)C(=O)NC1=C(C=CC(=C1)Br)Br)O |
Computed by PubChem (NCBI)