CAS 620103-87-9 appears in our catalog under these names: 5–Bromo–N–(quinolin–8–yl)thiophene–2–sulfonamide, 5-BROMO-N-QUINOLIN-8-YLTHIOPHENE-2-SULFONAMIDE, 97%, 97%, 5-Bromo-N-(quinolin-8-yl)thiophene-2-sulfonamide, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
5-bromo-N-quinolin-8-ylthiophene-2-sulfonamide (CAS 620103-87-9) is a chemical compound with the molecular formula C13H9BrN2O2S2 and a molecular weight of 369.3 g/mol. IUPAC name: 5-bromo-N-quinolin-8-ylthiophene-2-sulfonamide. InChIKey: BWZPDZRPJIBWAU-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2O2S2 |
|---|---|
| Molecular weight | 369.3 g/mol |
| IUPAC name | 5-bromo-N-quinolin-8-ylthiophene-2-sulfonamide |
| InChIKey | BWZPDZRPJIBWAU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)NS(=O)(=O)C3=CC=C(S3)Br)N=CC=C2 |
Computed by PubChem (NCBI)