CAS 620175-81-7 appears in our catalog under these names: 6-Chloro-1-methyl-1H-indole-3-carbaldehyde, 98%, 6-chloro-1-methyl-1H-indole-3-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 100mg.
6-chloro-1-methylindole-3-carbaldehyde (CAS 620175-81-7) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 6-chloro-1-methylindole-3-carbaldehyde. InChIKey: ZPCNJRXHEZRJSU-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 6-chloro-1-methylindole-3-carbaldehyde |
| InChIKey | ZPCNJRXHEZRJSU-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=C(C=C2)Cl)C=O |
Computed by PubChem (NCBI)