CAS 62037-41-6 appears in our catalog under these names: H-Ala-ala-phe-amc, 95%, H–Ala–Ala–Phe–AMC (free base), H-Ala-Ala-Phe-AMC, ALA-ALA-PHE 7-AMIDO-4-METHYLCOUMARIN, H-Ala-Ala-Phe-AMC, 10 mg. Offered by: Combi-blocks, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 250mg, 50mg, 25mg, 10mg, 5mg, 25 mg, 5 mg, 10 mg.
2-[2-(2-aminopropanoylamino)propanoylamino]-N-(4-methyl-2-oxochromen-7-yl)-3-phenylpropanamide (CAS 62037-41-6) is a chemical compound with the molecular formula C25H28N4O5 and a molecular weight of 464.5 g/mol. IUPAC name: 2-[2-(2-aminopropanoylamino)propanoylamino]-N-(4-methyl-2-oxochromen-7-yl)-3-phenylpropanamide. InChIKey: FVRLYIFIDKXFHU-UHFFFAOYSA-N.
| Molecular formula | C25H28N4O5 |
|---|---|
| Molecular weight | 464.5 g/mol |
| IUPAC name | 2-[2-(2-aminopropanoylamino)propanoylamino]-N-(4-methyl-2-oxochromen-7-yl)-3-phenylpropanamide |
| InChIKey | FVRLYIFIDKXFHU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)C(CC3=CC=CC=C3)NC(=O)C(C)NC(=O)C(C)N |
Computed by PubChem (NCBI)