CAS 6207-89-2 is the registry number for N-Hydroxynaphthalimide sodium salt, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
Sodium 2-oxidobenzo[de]isoquinoline-1,3-dione (CAS 6207-89-2) is a chemical compound with the molecular formula C12H6NNaO3 and a molecular weight of 235.17 g/mol. IUPAC name: sodium 2-oxidobenzo[de]isoquinoline-1,3-dione. InChIKey: VBWKQEZAOAAGNK-UHFFFAOYSA-N.
| Molecular formula | C12H6NNaO3 |
|---|---|
| Molecular weight | 235.17 g/mol |
| IUPAC name | sodium 2-oxidobenzo[de]isoquinoline-1,3-dione |
| InChIKey | VBWKQEZAOAAGNK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)N(C(=O)C3=CC=C2)[O-].[Na+] |
Computed by PubChem (NCBI)