CAS 62078-43-7 appears in our catalog under these names: 4-Nitro-1H-pyrazole-3,5-dicarboxylic acid, 96%, 4-Nitro-1H-pyrazole-3,5-dicarboxylic acid, 98%, 4-nitro-1H-pyrazole-3,5-dicarboxylic acid, 96%, 96%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg.
4-nitro-1H-pyrazole-3,5-dicarboxylic acid (CAS 62078-43-7) is a chemical compound with the molecular formula C5H3N3O6 and a molecular weight of 201.09 g/mol. IUPAC name: 4-nitro-1H-pyrazole-3,5-dicarboxylic acid. InChIKey: DEGBMJMGROCSHR-UHFFFAOYSA-N.
| Molecular formula | C5H3N3O6 |
|---|---|
| Molecular weight | 201.09 g/mol |
| IUPAC name | 4-nitro-1H-pyrazole-3,5-dicarboxylic acid |
| InChIKey | DEGBMJMGROCSHR-UHFFFAOYSA-N |
| SMILES | C1(=C(NN=C1C(=O)O)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)