CAS 620987-03-3 is the registry number for 1,2–BIS(TRICHLOROSILYL)DECANE. Offered by: GLPBio. Available pack sizes: 25g.
Trichloro(1-trichlorosilyldecan-2-yl)silane (CAS 620987-03-3) is a chemical compound with the molecular formula C10H20Cl6Si2 and a molecular weight of 409.1 g/mol. IUPAC name: trichloro(1-trichlorosilyldecan-2-yl)silane. InChIKey: FQBLNPKTABNRLQ-UHFFFAOYSA-N.
| Molecular formula | C10H20Cl6Si2 |
|---|---|
| Molecular weight | 409.1 g/mol |
| IUPAC name | trichloro(1-trichlorosilyldecan-2-yl)silane |
| InChIKey | FQBLNPKTABNRLQ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(C[Si](Cl)(Cl)Cl)[Si](Cl)(Cl)Cl |
Computed by PubChem (NCBI)