CAS 62192-75-0 appears in our catalog under these names: 2,4,5-Trimethyl-1h-benzimidazole, 95%, 2,4,5-Trimethyl-1H-benzimidazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 500mg.
2,4,5-trimethyl-1H-benzimidazole (CAS 62192-75-0) is a chemical compound with the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. IUPAC name: 2,4,5-trimethyl-1H-benzimidazole. InChIKey: MQOSRBNWLNRDOU-UHFFFAOYSA-N.
| Molecular formula | C10H12N2 |
|---|---|
| Molecular weight | 160.22 g/mol |
| IUPAC name | 2,4,5-trimethyl-1H-benzimidazole |
| InChIKey | MQOSRBNWLNRDOU-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)NC(=N2)C)C |
Computed by PubChem (NCBI)