CAS 622-42-4 appears in our catalog under these names: (Nitromethyl)benzene, 95%, α–Nitrotoluene, a-Nitrotoluene, ALPHA-NITROTOLUENE, 95%, (Nitromethyl)benzene, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Sigma-Aldrich, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 2g, 10g, 25g, 100MG.
Nitromethylbenzene (CAS 622-42-4) is a chemical compound with the molecular formula C7H7NO2 and a molecular weight of 137.14 g/mol. IUPAC name: nitromethylbenzene. InChIKey: VLZLOWPYUQHHCG-UHFFFAOYSA-N.
| Molecular formula | C7H7NO2 |
|---|---|
| Molecular weight | 137.14 g/mol |
| IUPAC name | nitromethylbenzene |
| InChIKey | VLZLOWPYUQHHCG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C[N+](=O)[O-] |
Computed by PubChem (NCBI)