CAS 622-69-5 appears in our catalog under these names: 1,5-Bis(4-nitrophenyl)carbohydrazide, 95%, 1,3-Bis((4-nitrophenyl)amino)urea. Offered by: AmBeed, Biosynth. Available pack sizes: 25g, 1g, 100mg.
1,3-bis(4-nitroanilino)urea (CAS 622-69-5) is a chemical compound with the molecular formula C13H12N6O5 and a molecular weight of 332.27 g/mol. IUPAC name: 1,3-bis(4-nitroanilino)urea. InChIKey: CEMQVKAEUMRRQJ-UHFFFAOYSA-N.
| Molecular formula | C13H12N6O5 |
|---|---|
| Molecular weight | 332.27 g/mol |
| IUPAC name | 1,3-bis(4-nitroanilino)urea |
| InChIKey | CEMQVKAEUMRRQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NNC(=O)NNC2=CC=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)