CAS 6220-31-1 appears in our catalog under these names: Regadenoson Impurity 31, Regadenoson Impurity 37. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R,4S,5R)-2-(2-amino-6-hydrazinylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 6220-31-1) is a chemical compound with the molecular formula C10H15N7O4 and a molecular weight of 297.27 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(2-amino-6-hydrazinylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: REEFXARZCXCDCA-UUOKFMHZSA-N.
| Molecular formula | C10H15N7O4 |
|---|---|
| Molecular weight | 297.27 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(2-amino-6-hydrazinylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | REEFXARZCXCDCA-UUOKFMHZSA-N |
| SMILES | C1=NC2=C(N=C(N=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N)NN |
Computed by PubChem (NCBI)