CAS 1189743-60-9 is the registry number for 5'-Hydrazino-5'-deoxyguanosine. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.
2-amino-9-[(2R,3R,4S,5R)-5-(hydrazinylmethyl)-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one (CAS 1189743-60-9) is a chemical compound with the molecular formula C10H15N7O4 and a molecular weight of 297.27 g/mol. IUPAC name: 2-amino-9-[(2R,3R,4S,5R)-5-(hydrazinylmethyl)-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one. InChIKey: LOYADLCSEREDBG-UUOKFMHZSA-N.
| Molecular formula | C10H15N7O4 |
|---|---|
| Molecular weight | 297.27 g/mol |
| IUPAC name | 2-amino-9-[(2R,3R,4S,5R)-5-(hydrazinylmethyl)-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one |
| InChIKey | LOYADLCSEREDBG-UUOKFMHZSA-N |
| SMILES | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CNN)O)O)N=C(NC2=O)N |
Computed by PubChem (NCBI)