CAS 62208-68-8 appears in our catalog under these names: Benzofuro(3,2–d)pyrimidine–2,4(1H,3H)–dione, Benzofuro[3,2-d]pyrimidine-2,4(1H,3H)-dione 95%, Benzofuro[3,2-d]pyrimidine-2,4(1H,3H)-dione, 95%, 95%, 1H-BENZO[4,5]FURO[3,2-D]PYRIMIDINE-2,4-DIONE, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100g, 250mg, 25g.
1H-[1]benzofuro[3,2-d]pyrimidine-2,4-dione (CAS 62208-68-8) is a chemical compound with the molecular formula C10H6N2O3 and a molecular weight of 202.17 g/mol. IUPAC name: 1H-[1]benzofuro[3,2-d]pyrimidine-2,4-dione. InChIKey: SLFPKTKTPDVQEX-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O3 |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | 1H-[1]benzofuro[3,2-d]pyrimidine-2,4-dione |
| InChIKey | SLFPKTKTPDVQEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C(=O)NC(=O)N3 |
Computed by PubChem (NCBI)