CAS 62240-27-1 appears in our catalog under these names: Bis(2,2,2-trifluoroethyl) phthalate, 95%, Bis(2,2,2-trifluoroethyl) phthalate, 95+%, Bis(2,2,2–trifluoroethyl) Phthalate (Standard for Phthalate GLC Determination), Bis(2,2,2-trifluoroethyl) Phthalate [Standard for Phthalate GLC Determination], >98.0%(T), Bis(2,2,2-trifluoroethyl) phthalate, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 100mg, 250mg, 10mg.
Bis(2,2,2-trifluoroethyl) benzene-1,2-dicarboxylate (CAS 62240-27-1) is a chemical compound with the molecular formula C12H8F6O4 and a molecular weight of 330.18 g/mol. IUPAC name: bis(2,2,2-trifluoroethyl) benzene-1,2-dicarboxylate. InChIKey: PSRBRNHUQJKQHV-UHFFFAOYSA-N.
| Molecular formula | C12H8F6O4 |
|---|---|
| Molecular weight | 330.18 g/mol |
| IUPAC name | bis(2,2,2-trifluoroethyl) benzene-1,2-dicarboxylate |
| InChIKey | PSRBRNHUQJKQHV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)OCC(F)(F)F)C(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)