CAS 62244-48-8 appears in our catalog under these names: Methoxy(4-methoxyphenyl)dimethylsilane, 95%, Methoxy(4-methoxyphenyl)dimethylsilane, >95% (HPLC). Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 1g, 100mg, 250mg.
Methoxy-(4-methoxyphenyl)-dimethylsilane (CAS 62244-48-8) is a chemical compound with the molecular formula C10H16O2Si and a molecular weight of 196.32 g/mol. IUPAC name: methoxy-(4-methoxyphenyl)-dimethylsilane. InChIKey: NYZIQYZVZFTFBF-UHFFFAOYSA-N.
| Molecular formula | C10H16O2Si |
|---|---|
| Molecular weight | 196.32 g/mol |
| IUPAC name | methoxy-(4-methoxyphenyl)-dimethylsilane |
| InChIKey | NYZIQYZVZFTFBF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)[Si](C)(C)OC |
Computed by PubChem (NCBI)