CAS 62247-00-1 appears in our catalog under these names: (3-Chlorophenyl)(pyridin-3-yl)methanone, 95%, 3-(3-Chlorobenzoyl)pyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
(3-chlorophenyl)-pyridin-3-ylmethanone (CAS 62247-00-1) is a chemical compound with the molecular formula C12H8ClNO and a molecular weight of 217.65 g/mol. IUPAC name: (3-chlorophenyl)-pyridin-3-ylmethanone. InChIKey: MDGKXQYPOIIMHW-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | (3-chlorophenyl)-pyridin-3-ylmethanone |
| InChIKey | MDGKXQYPOIIMHW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)