CAS 6226-01-3 is the registry number for 2-(Dimethylphosphoryl)acetic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
N-(4-chlorophenyl)-2-(4-methoxy-N-methylsulfonylanilino)acetamide (CAS 6226-01-3) is a chemical compound with the molecular formula C16H17ClN2O4S and a molecular weight of 368.8 g/mol. IUPAC name: N-(4-chlorophenyl)-2-(4-methoxy-N-methylsulfonylanilino)acetamide. InChIKey: JFUVSUWMLCNVKE-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN2O4S |
|---|---|
| Molecular weight | 368.8 g/mol |
| IUPAC name | N-(4-chlorophenyl)-2-(4-methoxy-N-methylsulfonylanilino)acetamide |
| InChIKey | JFUVSUWMLCNVKE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N(CC(=O)NC2=CC=C(C=C2)Cl)S(=O)(=O)C |
Computed by PubChem (NCBI)