CAS 62268-16-0 appears in our catalog under these names: 3,4,6-Trichlorophthalic acid, 95%, 3,4,6-Trichlorophthalic Acid, 3,4,6-Trichlorophthalic Acid, ≥97%, ≥97%, 1,2-BENZENEDICARBOXYLIC ACID,3,4,6-TRICHLORO-, ≥97%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100g, 10g, 25g.
3,4,6-trichlorophthalic acid (CAS 62268-16-0) is a chemical compound with the molecular formula C8H3Cl3O4 and a molecular weight of 269.5 g/mol. IUPAC name: 3,4,6-trichlorophthalic acid. InChIKey: DCACTBQREATMLX-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl3O4 |
|---|---|
| Molecular weight | 269.5 g/mol |
| IUPAC name | 3,4,6-trichlorophthalic acid |
| InChIKey | DCACTBQREATMLX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)C(=O)O)C(=O)O)Cl |
Computed by PubChem (NCBI)