CAS 6228-53-1 is the registry number for Zinc(II) succinate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Zinc butanedioate (CAS 6228-53-1) is a chemical compound with the molecular formula C4H4O4Zn and a molecular weight of 181.5 g/mol. IUPAC name: zinc butanedioate. InChIKey: AGFGXVAAIXIOFZ-UHFFFAOYSA-L.
| Molecular formula | C4H4O4Zn |
|---|---|
| Molecular weight | 181.5 g/mol |
| IUPAC name | zinc butanedioate |
| InChIKey | AGFGXVAAIXIOFZ-UHFFFAOYSA-L |
| SMILES | C(CC(=O)[O-])C(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)