CAS 622804-28-8 is the registry number for 6-Chloro-N-(1,3-thiazol-2-yl)pyridine-3-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-N-(1,3-thiazol-2-yl)pyridine-3-sulfonamide (CAS 622804-28-8) is a chemical compound with the molecular formula C8H6ClN3O2S2 and a molecular weight of 275.7 g/mol. IUPAC name: 6-chloro-N-(1,3-thiazol-2-yl)pyridine-3-sulfonamide. InChIKey: CCHVCPBBHPRKEI-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O2S2 |
|---|---|
| Molecular weight | 275.7 g/mol |
| IUPAC name | 6-chloro-N-(1,3-thiazol-2-yl)pyridine-3-sulfonamide |
| InChIKey | CCHVCPBBHPRKEI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1S(=O)(=O)NC2=NC=CS2)Cl |
Computed by PubChem (NCBI)