Products 62316-79-4

CAS 62316-79-4 is the registry number for 2-((Diphenylphosphoryl)(methyl)amino)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[diphenylphosphoryl(methyl)amino]acetic acid (CAS 62316-79-4) is a chemical compound with the molecular formula C15H16NO3P and a molecular weight of 289.27 g/mol. IUPAC name: 2-[diphenylphosphoryl(methyl)amino]acetic acid. InChIKey: ZQPHYRWKVXUKHI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16NO3P
Molecular weight289.27 g/mol
IUPAC name2-[diphenylphosphoryl(methyl)amino]acetic acid
InChIKeyZQPHYRWKVXUKHI-UHFFFAOYSA-N
SMILESCN(CC(=O)O)P(=O)(C1=CC=CC=C1)C2=CC=CC=C2

Computed by PubChem (NCBI)