CAS 623166-14-3 is the registry number for JYL 1511. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(4-tert-butylphenyl)methyl]-3-[[4-(methanesulfonamido)-3-methoxyphenyl]methyl]thiourea (CAS 623166-14-3) is a chemical compound with the molecular formula C21H29N3O3S2 and a molecular weight of 435.6 g/mol. IUPAC name: 1-[(4-tert-butylphenyl)methyl]-3-[[4-(methanesulfonamido)-3-methoxyphenyl]methyl]thiourea. InChIKey: QGFPXWPVMTWSAE-UHFFFAOYSA-N.
| Molecular formula | C21H29N3O3S2 |
|---|---|
| Molecular weight | 435.6 g/mol |
| IUPAC name | 1-[(4-tert-butylphenyl)methyl]-3-[[4-(methanesulfonamido)-3-methoxyphenyl]methyl]thiourea |
| InChIKey | QGFPXWPVMTWSAE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CNC(=S)NCC2=CC(=C(C=C2)NS(=O)(=O)C)OC |
Computed by PubChem (NCBI)