Products 623578-11-0
CAS 623578-11-0 is the registry number for KU-0058684. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg.
1-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]pyrrolidine-2,5-dione (CAS 623578-11-0) is a chemical compound with the molecular formula C19H14FN3O3 and a molecular weight of 351.3 g/mol. IUPAC name: 1-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]pyrrolidine-2,5-dione. InChIKey: YQSZNYLPVBOGPO-UHFFFAOYSA-N.
| Molecular formula | C19H14FN3O3 |
|---|---|
| Molecular weight | 351.3 g/mol |
| IUPAC name | 1-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]pyrrolidine-2,5-dione |
| InChIKey | YQSZNYLPVBOGPO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)C2=C(C=CC(=C2)CC3=NNC(=O)C4=CC=CC=C43)F |
Computed by PubChem (NCBI)