CAS 62362-63-4 appears in our catalog under these names: D-Manno-Gamma-lactam, D-Mannono-D-lactam. Offered by: TRC, Biosynth. Available pack sizes: 5mg, 2mg, 10mg.
(2S,3S,4R,5R)-5-amino-2,3,4,6-tetrahydroxyhexanoic acid (CAS 62362-63-4) is a chemical compound with the molecular formula C6H13NO6 and a molecular weight of 195.17 g/mol. IUPAC name: (2S,3S,4R,5R)-5-amino-2,3,4,6-tetrahydroxyhexanoic acid. InChIKey: TWRBLFYGIMLXMO-MBMOQRBOSA-N.
| Molecular formula | C6H13NO6 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | (2S,3S,4R,5R)-5-amino-2,3,4,6-tetrahydroxyhexanoic acid |
| InChIKey | TWRBLFYGIMLXMO-MBMOQRBOSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@@H](C(=O)O)O)O)O)N)O |
Computed by PubChem (NCBI)