CAS 6237-31-6 is the registry number for C 175. Offered by: MedChemExpress. Available pack sizes: Get quote.
N',N'-dimethyl-N-(3-nitroacridin-9-yl)butane-1,4-diamine;dihydrochloride (CAS 6237-31-6) is a chemical compound with the molecular formula C19H24Cl2N4O2 and a molecular weight of 411.3 g/mol. IUPAC name: N',N'-dimethyl-N-(3-nitroacridin-9-yl)butane-1,4-diamine;dihydrochloride. InChIKey: MDTDCJZYLQRIFA-UHFFFAOYSA-N.
| Molecular formula | C19H24Cl2N4O2 |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | N',N'-dimethyl-N-(3-nitroacridin-9-yl)butane-1,4-diamine;dihydrochloride |
| InChIKey | MDTDCJZYLQRIFA-UHFFFAOYSA-N |
| SMILES | CN(C)CCCCNC1=C2C=CC(=CC2=NC3=CC=CC=C31)[N+](=O)[O-].Cl.Cl |
Computed by PubChem (NCBI)