CAS 6239-48-1 appears in our catalog under these names: 2,2'-Biselenophene, 98%, 2,2'–Biselenophene. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g.
2-selenophen-2-ylselenophene (CAS 6239-48-1) is a chemical compound with the molecular formula C8H6Se2 and a molecular weight of 260.1 g/mol. IUPAC name: 2-selenophen-2-ylselenophene. InChIKey: YMQKWWIYQOIOKM-UHFFFAOYSA-N.
| Molecular formula | C8H6Se2 |
|---|---|
| Molecular weight | 260.1 g/mol |
| IUPAC name | 2-selenophen-2-ylselenophene |
| InChIKey | YMQKWWIYQOIOKM-UHFFFAOYSA-N |
| SMILES | C1=C[Se]C(=C1)C2=CC=C[Se]2 |
Computed by PubChem (NCBI)