Products 623903-26-4
CAS 623903-26-4 is the registry number for Tetrabromorhodamine 123 (bromide). Offered by: MedChemExpress. Available pack sizes: Get quote.
[6-amino-2,4,5,7-tetrabromo-9-(2-methoxycarbonylphenyl)xanthen-3-ylidene]azanium bromide (CAS 623903-26-4) is a chemical compound with the molecular formula C21H13Br5N2O3 and a molecular weight of 740.9 g/mol. IUPAC name: [6-amino-2,4,5,7-tetrabromo-9-(2-methoxycarbonylphenyl)xanthen-3-ylidene]azanium bromide. InChIKey: BGYAEVNNTNEWSJ-UHFFFAOYSA-N.
| Molecular formula | C21H13Br5N2O3 |
|---|---|
| Molecular weight | 740.9 g/mol |
| IUPAC name | [6-amino-2,4,5,7-tetrabromo-9-(2-methoxycarbonylphenyl)xanthen-3-ylidene]azanium bromide |
| InChIKey | BGYAEVNNTNEWSJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1C2=C3C=C(C(=[NH2+])C(=C3OC4=C(C(=C(C=C24)Br)N)Br)Br)Br.[Br-] |
Computed by PubChem (NCBI)