CAS 623943-52-2 is the registry number for 2-Methyl-5-(pentafluorosulfur)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-methyl-5-(pentafluoro-lambda6-sulfanyl)aniline (CAS 623943-52-2) is a chemical compound with the molecular formula C7H8F5NS and a molecular weight of 233.20 g/mol. IUPAC name: 2-methyl-5-(pentafluoro-lambda6-sulfanyl)aniline. InChIKey: IQTWYSPNHRBADI-UHFFFAOYSA-N.
| Molecular formula | C7H8F5NS |
|---|---|
| Molecular weight | 233.20 g/mol |
| IUPAC name | 2-methyl-5-(pentafluoro-lambda6-sulfanyl)aniline |
| InChIKey | IQTWYSPNHRBADI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(F)(F)(F)(F)F)N |
Computed by PubChem (NCBI)