CAS 6240-10-4 appears in our catalog under these names: 3-Amino-1-adamantanecarboxylic acid, 95%, 3-Aminoadamantane-1-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 100mg.
3-aminoadamantane-1-carboxylic acid (CAS 6240-10-4) is a chemical compound with the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. IUPAC name: 3-aminoadamantane-1-carboxylic acid. InChIKey: ZBPOKYGSYKBAAW-UHFFFAOYSA-N.
| Molecular formula | C11H17NO2 |
|---|---|
| Molecular weight | 195.26 g/mol |
| IUPAC name | 3-aminoadamantane-1-carboxylic acid |
| InChIKey | ZBPOKYGSYKBAAW-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)N)C(=O)O |
Computed by PubChem (NCBI)