CAS 62406-68-2 appears in our catalog under these names: 4-Bromo-2,6-dichloro-3-methylaniline 98%, 4-Bromo-2,6-dichloro-3-methylaniline, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
4-bromo-2,6-dichloro-3-methylaniline (CAS 62406-68-2) is a chemical compound with the molecular formula C7H6BrCl2N and a molecular weight of 254.94 g/mol. IUPAC name: 4-bromo-2,6-dichloro-3-methylaniline. InChIKey: YMEGPUJTODAJBS-UHFFFAOYSA-N.
| Molecular formula | C7H6BrCl2N |
|---|---|
| Molecular weight | 254.94 g/mol |
| IUPAC name | 4-bromo-2,6-dichloro-3-methylaniline |
| InChIKey | YMEGPUJTODAJBS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1Cl)N)Cl)Br |
Computed by PubChem (NCBI)