CAS 62406-72-8 appears in our catalog under these names: 2,4,6-Tribromo-3-nitroaniline, 95+%, 2,4,6-Tribromo-3-nitroaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 25g, 10g, 50g, 100g, 250g.
2,4,6-tribromo-3-nitroaniline (CAS 62406-72-8) is a chemical compound with the molecular formula C6H3Br3N2O2 and a molecular weight of 374.81 g/mol. IUPAC name: 2,4,6-tribromo-3-nitroaniline. InChIKey: WXKZWLNXOMHHIV-UHFFFAOYSA-N.
| Molecular formula | C6H3Br3N2O2 |
|---|---|
| Molecular weight | 374.81 g/mol |
| IUPAC name | 2,4,6-tribromo-3-nitroaniline |
| InChIKey | WXKZWLNXOMHHIV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)[N+](=O)[O-])Br)N)Br |
Computed by PubChem (NCBI)