CAS 62421-56-1 is the registry number for TL 99 hydrobromide. Offered by: GLPBio. Available pack sizes: 5mg.
6-(dimethylamino)-5,6,7,8-tetrahydronaphthalene-2,3-diol;hydrobromide (CAS 62421-56-1) is a chemical compound with the molecular formula C12H18BrNO2 and a molecular weight of 288.18 g/mol. IUPAC name: 6-(dimethylamino)-5,6,7,8-tetrahydronaphthalene-2,3-diol;hydrobromide. InChIKey: QOYGBUAAWCEXPD-UHFFFAOYSA-N.
| Molecular formula | C12H18BrNO2 |
|---|---|
| Molecular weight | 288.18 g/mol |
| IUPAC name | 6-(dimethylamino)-5,6,7,8-tetrahydronaphthalene-2,3-diol;hydrobromide |
| InChIKey | QOYGBUAAWCEXPD-UHFFFAOYSA-N |
| SMILES | CN(C)C1CCC2=CC(=C(C=C2C1)O)O.Br |
Computed by PubChem (NCBI)