CAS 62441-54-7 is the registry number for Fluofenamine. Offered by: TRC. Available pack sizes: 5mg.
N-[2-chloro-5-(trifluoromethyl)phenyl]-2,4-dinitro-6-(trifluoromethyl)aniline (CAS 62441-54-7) is a chemical compound with the molecular formula C14H6ClF6N3O4 and a molecular weight of 429.66 g/mol. IUPAC name: N-[2-chloro-5-(trifluoromethyl)phenyl]-2,4-dinitro-6-(trifluoromethyl)aniline. InChIKey: FVJQBZVCJVMBIP-UHFFFAOYSA-N.
| Molecular formula | C14H6ClF6N3O4 |
|---|---|
| Molecular weight | 429.66 g/mol |
| IUPAC name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2,4-dinitro-6-(trifluoromethyl)aniline |
| InChIKey | FVJQBZVCJVMBIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)NC2=C(C=C(C=C2[N+](=O)[O-])[N+](=O)[O-])C(F)(F)F)Cl |
Computed by PubChem (NCBI)