Products 6245-60-9
CAS 6245-60-9 is the registry number for Acid red 42. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 6-amino-5-[[2-(benzenesulfonyl)phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonate (CAS 6245-60-9) is a chemical compound with the molecular formula C22H16N3NaO6S2 and a molecular weight of 505.5 g/mol. IUPAC name: sodium 6-amino-5-[[2-(benzenesulfonyl)phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonate. InChIKey: HJBFOCFLBVMVCF-UHFFFAOYSA-M.
| Molecular formula | C22H16N3NaO6S2 |
|---|---|
| Molecular weight | 505.5 g/mol |
| IUPAC name | sodium 6-amino-5-[[2-(benzenesulfonyl)phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonate |
| InChIKey | HJBFOCFLBVMVCF-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C2=CC=CC=C2N=NC3=C(C=CC4=CC(=CC(=C43)O)S(=O)(=O)[O-])N.[Na+] |
Computed by PubChem (NCBI)