CAS 62458-22-4 is the registry number for 1,2-benzothiazol-3-amine hydrochloride, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,2-benzothiazol-3-amine;hydrochloride (CAS 62458-22-4) is a chemical compound with the molecular formula C7H7ClN2S and a molecular weight of 186.66 g/mol. IUPAC name: 1,2-benzothiazol-3-amine;hydrochloride. InChIKey: XQWSSFUKASBFLW-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2S |
|---|---|
| Molecular weight | 186.66 g/mol |
| IUPAC name | 1,2-benzothiazol-3-amine;hydrochloride |
| InChIKey | XQWSSFUKASBFLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NS2)N.Cl |
Computed by PubChem (NCBI)