Products 62458-22-4

CAS 62458-22-4 is the registry number for 1,2-benzothiazol-3-amine hydrochloride, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1,2-benzothiazol-3-amine;hydrochloride (CAS 62458-22-4) is a chemical compound with the molecular formula C7H7ClN2S and a molecular weight of 186.66 g/mol. IUPAC name: 1,2-benzothiazol-3-amine;hydrochloride. InChIKey: XQWSSFUKASBFLW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7ClN2S
Molecular weight186.66 g/mol
IUPAC name1,2-benzothiazol-3-amine;hydrochloride
InChIKeyXQWSSFUKASBFLW-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=NS2)N.Cl

Computed by PubChem (NCBI)