Products 62458-42-8
CAS 62458-42-8 is the registry number for Pterodonoic acid. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
2-[(2R,4aS)-4a,8-dimethyl-7-oxo-1,2,3,4,5,6-hexahydronaphthalen-2-yl]prop-2-enoic acid (CAS 62458-42-8) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: 2-[(2R,4aS)-4a,8-dimethyl-7-oxo-1,2,3,4,5,6-hexahydronaphthalen-2-yl]prop-2-enoic acid. InChIKey: RDGFGQJFNSCICW-ABAIWWIYSA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | 2-[(2R,4aS)-4a,8-dimethyl-7-oxo-1,2,3,4,5,6-hexahydronaphthalen-2-yl]prop-2-enoic acid |
| InChIKey | RDGFGQJFNSCICW-ABAIWWIYSA-N |
| SMILES | CC1=C2C[C@@H](CC[C@]2(CCC1=O)C)C(=C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Pterodonoic acid, orb1680282