CAS 624726-35-8 is the registry number for 1-(4-Iodophenyl)piperazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(4-iodophenyl)piperazine;hydrochloride (CAS 624726-35-8) is a chemical compound with the molecular formula C10H14ClIN2 and a molecular weight of 324.59 g/mol. IUPAC name: 1-(4-iodophenyl)piperazine;hydrochloride. InChIKey: AABZSGMNVRFNHN-UHFFFAOYSA-N.
| Molecular formula | C10H14ClIN2 |
|---|---|
| Molecular weight | 324.59 g/mol |
| IUPAC name | 1-(4-iodophenyl)piperazine;hydrochloride |
| InChIKey | AABZSGMNVRFNHN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)I.Cl |
Computed by PubChem (NCBI)