CAS 625-89-8 is the registry number for 2,2,2-Trifluoro-N-nitroso-N-(2,2,2-trifluoroethyl)ethanamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
N,N-bis(2,2,2-trifluoroethyl)nitrous amide (CAS 625-89-8) is a chemical compound with the molecular formula C4H4F6N2O and a molecular weight of 210.08 g/mol. IUPAC name: N,N-bis(2,2,2-trifluoroethyl)nitrous amide. InChIKey: YUEXLPFBTMPXCY-UHFFFAOYSA-N.
| Molecular formula | C4H4F6N2O |
|---|---|
| Molecular weight | 210.08 g/mol |
| IUPAC name | N,N-bis(2,2,2-trifluoroethyl)nitrous amide |
| InChIKey | YUEXLPFBTMPXCY-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)N(CC(F)(F)F)N=O |
Computed by PubChem (NCBI)