Products 625-89-8

CAS 625-89-8 is the registry number for 2,2,2-Trifluoro-N-nitroso-N-(2,2,2-trifluoroethyl)ethanamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

N,N-bis(2,2,2-trifluoroethyl)nitrous amide (CAS 625-89-8) is a chemical compound with the molecular formula C4H4F6N2O and a molecular weight of 210.08 g/mol. IUPAC name: N,N-bis(2,2,2-trifluoroethyl)nitrous amide. InChIKey: YUEXLPFBTMPXCY-UHFFFAOYSA-N.

Identity
Molecular formulaC4H4F6N2O
Molecular weight210.08 g/mol
IUPAC nameN,N-bis(2,2,2-trifluoroethyl)nitrous amide
InChIKeyYUEXLPFBTMPXCY-UHFFFAOYSA-N
SMILESC(C(F)(F)F)N(CC(F)(F)F)N=O

Computed by PubChem (NCBI)