CAS 62507-01-1 is the registry number for 3'-Benzyloxy-5,7-dihydroxy-3,4'-dimethoxyflavone, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
5,7-dihydroxy-3-methoxy-2-(4-methoxy-3-phenylmethoxyphenyl)chromen-4-one (CAS 62507-01-1) is a chemical compound with the molecular formula C24H20O7 and a molecular weight of 420.4 g/mol. IUPAC name: 5,7-dihydroxy-3-methoxy-2-(4-methoxy-3-phenylmethoxyphenyl)chromen-4-one. InChIKey: JPEXDMDZYIHQEF-UHFFFAOYSA-N.
| Molecular formula | C24H20O7 |
|---|---|
| Molecular weight | 420.4 g/mol |
| IUPAC name | 5,7-dihydroxy-3-methoxy-2-(4-methoxy-3-phenylmethoxyphenyl)chromen-4-one |
| InChIKey | JPEXDMDZYIHQEF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)