CAS 625110-37-4 appears in our catalog under these names: DPP–IV–IN–1, DPP-IV-IN-1, 99.29%, 99.29%, TS-021 (free base), 98.84%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 5 mg, 10mM/1mL, 25 mg, 100 mg, 50 mg.
(2S,4S)-4-fluoro-1-[2-[(1-hydroxy-2-methylpropan-2-yl)amino]acetyl]pyrrolidine-2-carbonitrile (CAS 625110-37-4) is a chemical compound with the molecular formula C11H18FN3O2 and a molecular weight of 243.28 g/mol. IUPAC name: (2S,4S)-4-fluoro-1-[2-[(1-hydroxy-2-methylpropan-2-yl)amino]acetyl]pyrrolidine-2-carbonitrile. InChIKey: XJGUWEAPKPNAID-IUCAKERBSA-N.
| Molecular formula | C11H18FN3O2 |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | (2S,4S)-4-fluoro-1-[2-[(1-hydroxy-2-methylpropan-2-yl)amino]acetyl]pyrrolidine-2-carbonitrile |
| InChIKey | XJGUWEAPKPNAID-IUCAKERBSA-N |
| SMILES | CC(C)(CO)NCC(=O)N1C[C@H](C[C@H]1C#N)F |
Computed by PubChem (NCBI)