CAS 625122-29-4 is the registry number for B-[3,3′′,5,5′′-tetrakis(trifluoromethyl)[1,1′:3′,1′′-terphenyl]-5′-yl]-Boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]boronic acid (CAS 625122-29-4) is a chemical compound with the molecular formula C22H11BF12O2 and a molecular weight of 546.1 g/mol. IUPAC name: [3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]boronic acid. InChIKey: JDHRZDJTNJZRTF-UHFFFAOYSA-N.
| Molecular formula | C22H11BF12O2 |
|---|---|
| Molecular weight | 546.1 g/mol |
| IUPAC name | [3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]boronic acid |
| InChIKey | JDHRZDJTNJZRTF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)